![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/binary.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| OtherWebLinks.txt | 2020-03-27 17:34 | 294 | |
| Thumbs.db | 2017-05-04 05:09 | 29K | |
| Sample Program 2.ppt | 2011-01-17 11:26 | 118K | |
| Sample Program 1.ppt | 2010-01-06 14:49 | 123K | |
| CSE 3.6.1 Assignment..> | 2020-05-13 13:46 | 148K | |
| 1 C Language Introdu..> | 2015-07-30 11:39 | 175K | |
| 2 C Program Structur..> | 2010-01-02 16:01 | 481K | |
| TurboC_7_v2.0.exe | 2020-01-28 11:13 | 3.6M | |
| C_Material.pdf | 2015-11-23 13:45 | 5.1M | |
| CSE 3.6.1 Practical ..> | 2017-03-10 15:14 | 5.4M | |
| Variable Static.mp4 | 2020-04-20 09:58 | 8.6M | |
| Structure Introducti..> | 2020-04-13 11:27 | 12M | |
| Variable Local-Globa..> | 2020-04-20 09:58 | 12M | |
| UDF simple and argum..> | 2020-04-06 10:04 | 14M | |
| UDF with return.mp4 | 2020-04-06 10:28 | 14M | |
| TC.zip | 2020-01-20 12:08 | 15M | |
| UDF Basic.mp4 | 2020-04-06 10:02 | 15M | |
| Structure Program.mp4 | 2020-04-13 11:29 | 21M | |